Difference between revisions of "OROTATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ14679 == * transcription-direction: ** negative * right-end-position: ** 74182 * left-end-position: ** 61555 * centisome-position: ** 19.815605...") |
(Created page with "Category:metabolite == Metabolite OROTATE == * common-name: ** orotate * smiles: ** c1(=c(c([o-])=o)nc(nc(=o)1)=o) * inchi-key: ** pxqpewdeaktcgb-uhfffaoysa-m * molecular-...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite OROTATE == |
| − | * | + | * common-name: |
| − | ** | + | ** orotate |
| − | * | + | * smiles: |
| − | ** | + | ** c1(=c(c([o-])=o)nc(nc(=o)1)=o) |
| − | * | + | * inchi-key: |
| − | ** | + | ** pxqpewdeaktcgb-uhfffaoysa-m |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 155.09 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[OROPRIBTRANS-RXN]] |
| − | == Reaction(s) | + | * [[ORPRT]] |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | ** | + | * [[DIHYDROOROTATE-DEHYDROGENASE-RXN]] |
| − | * | + | * [[OROPRIBTRANS-RXN]] |
| − | {{#set: | + | * [[ORPRT]] |
| − | {{#set: | + | * [[RXN0-6491]] |
| − | + | * [[RXN0-6554]] | |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=orotate}} | |
| − | + | {{#set: inchi-key=inchikey=pxqpewdeaktcgb-uhfffaoysa-m}} | |
| + | {{#set: molecular-weight=155.09}} | ||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite OROTATE
- common-name:
- orotate
- smiles:
- c1(=c(c([o-])=o)nc(nc(=o)1)=o)
- inchi-key:
- pxqpewdeaktcgb-uhfffaoysa-m
- molecular-weight:
- 155.09
