Difference between revisions of "OROTATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2E-7Z-hexadeca-2-7-dienoyl-ACPs == * common-name: ** a (2e,7z)-hexadeca-2,7-dienoyl-[acp] == Reaction(s) known to consume the compound ==...")
(Created page with "Category:metabolite == Metabolite OROTATE == * common-name: ** orotate * smiles: ** c1(=c(c([o-])=o)nc(nc(=o)1)=o) * inchi-key: ** pxqpewdeaktcgb-uhfffaoysa-m * molecular-...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2E-7Z-hexadeca-2-7-dienoyl-ACPs ==
+
== Metabolite OROTATE ==
 
* common-name:
 
* common-name:
** a (2e,7z)-hexadeca-2,7-dienoyl-[acp]
+
** orotate
 +
* smiles:
 +
** c1(=c(c([o-])=o)nc(nc(=o)1)=o)
 +
* inchi-key:
 +
** pxqpewdeaktcgb-uhfffaoysa-m
 +
* molecular-weight:
 +
** 155.09
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16624]]
+
* [[OROPRIBTRANS-RXN]]
 +
* [[ORPRT]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16623]]
+
* [[DIHYDROOROTATE-DEHYDROGENASE-RXN]]
 +
* [[OROPRIBTRANS-RXN]]
 +
* [[ORPRT]]
 +
* [[RXN0-6491]]
 +
* [[RXN0-6554]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a (2e,7z)-hexadeca-2,7-dienoyl-[acp]}}
+
{{#set: common-name=orotate}}
 +
{{#set: inchi-key=inchikey=pxqpewdeaktcgb-uhfffaoysa-m}}
 +
{{#set: molecular-weight=155.09}}

Latest revision as of 11:11, 18 March 2021

Metabolite OROTATE

  • common-name:
    • orotate
  • smiles:
    • c1(=c(c([o-])=o)nc(nc(=o)1)=o)
  • inchi-key:
    • pxqpewdeaktcgb-uhfffaoysa-m
  • molecular-weight:
    • 155.09

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality