Difference between revisions of "OROTATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ11887 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * [[ATP_LPAREN_3h_RPAREN_tm]...") |
(Created page with "Category:metabolite == Metabolite OROTATE == * common-name: ** orotate * smiles: ** c1(=c(c([o-])=o)nc(nc(=o)1)=o) * inchi-key: ** pxqpewdeaktcgb-uhfffaoysa-m * molecular-...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite OROTATE == |
− | == | + | * common-name: |
− | * [[ | + | ** orotate |
− | == Reaction(s) | + | * smiles: |
− | * [[ | + | ** c1(=c(c([o-])=o)nc(nc(=o)1)=o) |
− | ** | + | * inchi-key: |
− | * | + | ** pxqpewdeaktcgb-uhfffaoysa-m |
− | {{#set: | + | * molecular-weight: |
− | {{#set: | + | ** 155.09 |
+ | == Reaction(s) known to consume the compound == | ||
+ | * [[OROPRIBTRANS-RXN]] | ||
+ | * [[ORPRT]] | ||
+ | == Reaction(s) known to produce the compound == | ||
+ | * [[DIHYDROOROTATE-DEHYDROGENASE-RXN]] | ||
+ | * [[OROPRIBTRANS-RXN]] | ||
+ | * [[ORPRT]] | ||
+ | * [[RXN0-6491]] | ||
+ | * [[RXN0-6554]] | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=orotate}} | ||
+ | {{#set: inchi-key=inchikey=pxqpewdeaktcgb-uhfffaoysa-m}} | ||
+ | {{#set: molecular-weight=155.09}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite OROTATE
- common-name:
- orotate
- smiles:
- c1(=c(c([o-])=o)nc(nc(=o)1)=o)
- inchi-key:
- pxqpewdeaktcgb-uhfffaoysa-m
- molecular-weight:
- 155.09