Difference between revisions of "OROTIDINE-5-PHOSPHATE"

Latest revision as of 11:16, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite N6N6N6-TRIMETHYL-L-LYSINE ==
+== Metabolite OROTIDINE-5-PHOSPHATE ==
 * common-name:
-** n6,n6,n6-trimethyl-l-lysine
+** orotidine 5'-phosphate
 * smiles:
-** c[n+](ccccc(c([o-])=o)[n+])(c)c
+** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c(c(=o)[o-])=cc(=o)nc(=o)2))
 * inchi-key:
-** mxnrlfusfkvqsk-qmmmgpobsa-o
+** kyobshfobaofbf-xvfcmesisa-k
 * molecular-weight:
-** 189.277
+** 365.17
 == Reaction(s) known to consume the compound ==
-* [[TRIMETHYLLYSINE-DIOXYGENASE-RXN]]
+* [[OROPRIBTRANS-RXN]]
+* [[OROTPDECARB-RXN]]
+* [[ORPDC]]
+* [[ORPRT]]
 == Reaction(s) known to produce the compound ==
+* [[OROPRIBTRANS-RXN]]
+* [[ORPRT]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=n6,n6,n6-trimethyl-l-lysine}}
+{{#set: common-name=orotidine 5'-phosphate}}
-{{#set: inchi-key=inchikey=mxnrlfusfkvqsk-qmmmgpobsa-o}}
+{{#set: inchi-key=inchikey=kyobshfobaofbf-xvfcmesisa-k}}
-{{#set: molecular-weight=189.277}}
+{{#set: molecular-weight=365.17}}