Difference between revisions of "OROTIDINE-5-PHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PHE-tRNAs == * common-name: ** a trnaphe == Reaction(s) known to consume the compound == * PHENYLALANINE--TRNA-LIGASE-RXN == Reaction...") |
(Created page with "Category:metabolite == Metabolite OROTIDINE-5-PHOSPHATE == * common-name: ** orotidine 5'-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c(c(=o)[o-])=cc(=o)n...") |
||
(5 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite OROTIDINE-5-PHOSPHATE == |
* common-name: | * common-name: | ||
− | ** | + | ** orotidine 5'-phosphate |
+ | * smiles: | ||
+ | ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c(c(=o)[o-])=cc(=o)nc(=o)2)) | ||
+ | * inchi-key: | ||
+ | ** kyobshfobaofbf-xvfcmesisa-k | ||
+ | * molecular-weight: | ||
+ | ** 365.17 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[OROPRIBTRANS-RXN]] |
+ | * [[OROTPDECARB-RXN]] | ||
+ | * [[ORPDC]] | ||
+ | * [[ORPRT]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[OROPRIBTRANS-RXN]] | ||
+ | * [[ORPRT]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=orotidine 5'-phosphate}} |
+ | {{#set: inchi-key=inchikey=kyobshfobaofbf-xvfcmesisa-k}} | ||
+ | {{#set: molecular-weight=365.17}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite OROTIDINE-5-PHOSPHATE
- common-name:
- orotidine 5'-phosphate
- smiles:
- c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c(c(=o)[o-])=cc(=o)nc(=o)2))
- inchi-key:
- kyobshfobaofbf-xvfcmesisa-k
- molecular-weight:
- 365.17