Difference between revisions of "OROTIDINE-5-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.11.14-RXN 2.7.11.14-RXN] == * direction: ** reversible * common-name: ** rhodopsin kinase * ec-...")
 
(Created page with "Category:metabolite == Metabolite OROTIDINE-5-PHOSPHATE == * common-name: ** orotidine 5'-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c(c(=o)[o-])=cc(=o)n...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.11.14-RXN 2.7.11.14-RXN] ==
+
== Metabolite OROTIDINE-5-PHOSPHATE ==
* direction:
 
** reversible
 
 
* common-name:
 
* common-name:
** rhodopsin kinase
+
** orotidine 5'-phosphate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.7.11.14 ec-2.7.11.14]
+
** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c(c(=o)[o-])=cc(=o)nc(=o)2))
== Reaction formula ==
+
* inchi-key:
* 1 [[ATP]][c] '''+''' 1 [[Rhodopsins]][c] '''<=>''' 1 [[ADP]][c] '''+''' 1 [[PHOSPHORHODOPSIN]][c]
+
** kyobshfobaofbf-xvfcmesisa-k
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ20921]]
+
** 365.17
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[OROPRIBTRANS-RXN]]
== Pathway(s) ==
+
* [[OROTPDECARB-RXN]]
== Reconstruction information  ==
+
* [[ORPDC]]
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[ORPRT]]
== External links  ==
+
== Reaction(s) known to produce the compound ==
{{#set: direction=reversible}}
+
* [[OROPRIBTRANS-RXN]]
{{#set: common-name=rhodopsin kinase}}
+
* [[ORPRT]]
{{#set: ec-number=ec-2.7.11.14}}
+
== Reaction(s) of unknown directionality ==
{{#set: nb gene associated=1}}
+
{{#set: common-name=orotidine 5'-phosphate}}
{{#set: nb pathway associated=0}}
+
{{#set: inchi-key=inchikey=kyobshfobaofbf-xvfcmesisa-k}}
{{#set: reconstruction category=annotation}}
+
{{#set: molecular-weight=365.17}}
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite OROTIDINE-5-PHOSPHATE

  • common-name:
    • orotidine 5'-phosphate
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c(c(=o)[o-])=cc(=o)nc(=o)2))
  • inchi-key:
    • kyobshfobaofbf-xvfcmesisa-k
  • molecular-weight:
    • 365.17

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality