Difference between revisions of "OROTIDINE-5-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16121 RXN-16121] == * direction: ** left-to-right * common-name: ** phosphatidate phosphatase *...")
(Created page with "Category:metabolite == Metabolite N6N6N6-TRIMETHYL-L-LYSINE == * common-name: ** n6,n6,n6-trimethyl-l-lysine * smiles: ** c[n+](ccccc(c([o-])=o)[n+])(c)c * inchi-key: ** m...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16121 RXN-16121] ==
+
== Metabolite N6N6N6-TRIMETHYL-L-LYSINE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** phosphatidate phosphatase
+
** n6,n6,n6-trimethyl-l-lysine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/3.1.3.4 ec-3.1.3.4]
+
** c[n+](ccccc(c([o-])=o)[n+])(c)c
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-17373]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-17375]][c] '''+''' 1 [[Pi]][c]
+
** mxnrlfusfkvqsk-qmmmgpobsa-o
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ13957]]
+
** 189.277
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[TRIMETHYLLYSINE-DIOXYGENASE-RXN]]
−
* Gene: [[SJ21389]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=n6,n6,n6-trimethyl-l-lysine}}
−
* Gene: [[SJ07066]]
+
{{#set: inchi-key=inchikey=mxnrlfusfkvqsk-qmmmgpobsa-o}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=189.277}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ07984]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ21676]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
== Pathway(s) ==
 
−
* [[PWY-6453]], stigma estolide biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6453 PWY-6453]
 
−
** '''3''' reactions found over '''7''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=phosphatidate phosphatase}}
 
−
{{#set: ec-number=ec-3.1.3.4}}
 
−
{{#set: nb gene associated=5}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:35, 18 December 2020

Metabolite N6N6N6-TRIMETHYL-L-LYSINE

  • common-name:
    • n6,n6,n6-trimethyl-l-lysine
  • smiles:
    • c[n+](ccccc(c([o-])=o)[n+])(c)c
  • inchi-key:
    • mxnrlfusfkvqsk-qmmmgpobsa-o
  • molecular-weight:
    • 189.277

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=OROTIDINE-5-PHOSPHATE&oldid=47740"