Difference between revisions of "P105-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14927 CPD-14927] == * common-name: ** phytenate * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=cc(...")
(Created page with "Category:pathway == Pathway PWY-7053 == * taxonomic-range: ** tax-2759 ** tax-3041 ** tax-3208 * common-name: ** docosahexaenoate biosynthesis i (lower eukaryotes) == Reac...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14927 CPD-14927] ==
+
== Pathway PWY-7053 ==
 +
* taxonomic-range:
 +
** tax-2759
 +
** tax-3041
 +
** tax-3208
 
* common-name:
 
* common-name:
** phytenate
+
** docosahexaenoate biosynthesis i (lower eukaryotes)
* smiles:
+
== Reaction(s) found ==
** cc(c)cccc(c)cccc(c)cccc(c)=cc(=o)[o-]
+
* [[RXN-13443]]
* inchi-key:
+
* [[RXN-13444]]
** wdwbnnbrpveeod-pfxvradusa-m
+
* [[RXN-17688]]
* molecular-weight:
+
== Reaction(s) not found ==
** 309.511
+
* [NoneRXN-13442 RXN-13442]
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-13445 RXN-13445]
* [[RXN66-480]]
+
* [NoneRXN-12797 RXN-12797]
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-16102 RXN-16102]
* [[RXN66-479]]
+
{{#set: taxonomic-range=tax-3041|tax-3208|tax-2759}}
== Reaction(s) of unknown directionality ==
+
{{#set: common-name=docosahexaenoate biosynthesis i (lower eukaryotes)}}
{{#set: common-name=phytenate}}
+
{{#set: nb reaction found=3}}
{{#set: inchi-key=inchikey=wdwbnnbrpveeod-pfxvradusa-m}}
+
{{#set: completion rate=0.43}}
{{#set: molecular-weight=309.511}}
+
{{#set: nb total reaction=7}}

Revision as of 20:17, 18 December 2020

Pathway PWY-7053

  • taxonomic-range:
    • tax-2759
    • tax-3041
    • tax-3208
  • common-name:
    • docosahexaenoate biosynthesis i (lower eukaryotes)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-13442 RXN-13442]
  • [NoneRXN-13445 RXN-13445]
  • [NoneRXN-12797 RXN-12797]
  • [NoneRXN-16102 RXN-16102]