Difference between revisions of "PWY-5101"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCDP DCDP] == * common-name: ** dcdp * smiles: ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(=o)...")
(Created page with "Category:pathway == Pathway PWY-5101 == * taxonomic-range: ** tax-183924 ** tax-224756 ** tax-183925 ** tax-203691 ** tax-183939 * common-name: ** l-isoleucine biosynthesi...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCDP DCDP] ==
+
== Pathway PWY-5101 ==
 +
* taxonomic-range:
 +
** tax-183924
 +
** tax-224756
 +
** tax-183925
 +
** tax-203691
 +
** tax-183939
 
* common-name:
 
* common-name:
** dcdp
+
** l-isoleucine biosynthesis ii
* smiles:
+
== Reaction(s) found ==
** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(=o)([o-])[o-])([o-])=o
+
* [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]]
* inchi-key:
+
* [[DIHYDROXYMETVALDEHYDRAT-RXN]]
** ftdhdkpuhblbtl-shyzeuofsa-k
+
* [[R-2-METHYLMALATE-DEHYDRATASE-RXN]]
* molecular-weight:
+
* [[RXN-7745]]
** 384.155
+
== Reaction(s) not found ==
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-7744 RXN-7744]
* [[ATDCD]]
+
* [NoneRXN-7743 RXN-7743]
* [[ATDCDm]]
+
* [NoneRXN-16062 RXN-16062]
* [[DCDPKIN-RXN]]
+
* [NoneACETOOHBUTSYN-RXN ACETOOHBUTSYN-RXN]
* [[DCTPtm]]
+
{{#set: taxonomic-range=tax-224756|tax-183939|tax-203691|tax-183925|tax-183924}}
* [[RXN-14187]]
+
{{#set: common-name=l-isoleucine biosynthesis ii}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb reaction found=4}}
* [[ATDCM]]
+
{{#set: completion rate=0.5}}
* [[CDPREDUCT-RXN]]
+
{{#set: nb total reaction=8}}
* [[DCDT]]
 
* [[DCTCP]]
 
* [[DCTPtm]]
 
* [[DCTUP]]
 
* [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]]
 
* [[RXN-14216]]
 
* [[RXN-7913]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=dcdp}}
 
{{#set: inchi-key=inchikey=ftdhdkpuhblbtl-shyzeuofsa-k}}
 
{{#set: molecular-weight=384.155}}
 

Latest revision as of 10:59, 18 March 2021

Pathway PWY-5101

  • taxonomic-range:
    • tax-183924
    • tax-224756
    • tax-183925
    • tax-203691
    • tax-183939
  • common-name:
    • l-isoleucine biosynthesis ii

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-7744 RXN-7744]
  • [NoneRXN-7743 RXN-7743]
  • [NoneRXN-16062 RXN-16062]
  • [NoneACETOOHBUTSYN-RXN ACETOOHBUTSYN-RXN]