Difference between revisions of "PWY-5101"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAQUINONE DOPAQUINONE] ==
+== Pathway PWY-5101 ==
+* taxonomic-range:
+** tax-183924
+** tax-224756
+** tax-183925
+** tax-203691
+** tax-183939
 * common-name:
-** dopaquinone
+** l-isoleucine biosynthesis ii
-* smiles:
+== Reaction(s) found ==
-** c([o-])(=o)c([n+])cc1(=cc(=o)c(=o)c=c1)
+* [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]]
-* inchi-key:
+* [[DIHYDROXYMETVALDEHYDRAT-RXN]]
-** ahmiduvksgchau-lurjtmiesa-n
+* [[R-2-METHYLMALATE-DEHYDRATASE-RXN]]
-* molecular-weight:
+* [[RXN-7745]]
-** 195.174
+== Reaction(s) not found ==
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-7744 RXN-7744]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-7743 RXN-7743]
-* [[MONOPHENOL-MONOOXYGENASE-RXN]]
+* [NoneRXN-16062 RXN-16062]
-* [[RXN-13061]]
+* [NoneACETOOHBUTSYN-RXN ACETOOHBUTSYN-RXN]
-== Reaction(s) of unknown directionality ==
+{{#set: taxonomic-range=tax-224756|tax-183939|tax-203691|tax-183925|tax-183924}}
-{{#set: common-name=dopaquinone}}
+{{#set: common-name=l-isoleucine biosynthesis ii}}
-{{#set: inchi-key=inchikey=ahmiduvksgchau-lurjtmiesa-n}}
+{{#set: nb reaction found=4}}
-{{#set: molecular-weight=195.174}}
+{{#set: completion rate=0.5}}
+{{#set: nb total reaction=8}}