Difference between revisions of "PWY-5135"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-281 CPD-281] == * common-name: ** s-(2-methylpropanoyl)-dihydrolipoamide * smiles: ** cc(c(...")
(Created page with "Category:pathway == Pathway PWY-5135 == * taxonomic-range: ** tax-3481 * common-name: ** xanthohumol biosynthesis == Reaction(s) found == * 4-COUMARATE--COA-LIGASE-RXN...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-281 CPD-281] ==
+
== Pathway PWY-5135 ==
 +
* taxonomic-range:
 +
** tax-3481
 
* common-name:
 
* common-name:
** s-(2-methylpropanoyl)-dihydrolipoamide
+
** xanthohumol biosynthesis
* smiles:
+
== Reaction(s) found ==
** cc(c(sc(ccccc(n)=o)ccs)=o)c
+
* [[4-COUMARATE--COA-LIGASE-RXN]]
* inchi-key:
+
* [[NARINGENIN-CHALCONE-SYNTHASE-RXN]]
** xzukurpvwdtxge-uhfffaoysa-n
+
== Reaction(s) not found ==
* molecular-weight:
+
* [NoneRXN-7821 RXN-7821]
** 277.439
+
* [NoneRXN-7820 RXN-7820]
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-3481}}
* [[DHRT_LPAREN_ibcoa_RPAREN_]]
+
{{#set: common-name=xanthohumol biosynthesis}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb reaction found=2}}
== Reaction(s) of unknown directionality ==
+
{{#set: completion rate=0.5}}
{{#set: common-name=s-(2-methylpropanoyl)-dihydrolipoamide}}
+
{{#set: nb total reaction=4}}
{{#set: inchi-key=inchikey=xzukurpvwdtxge-uhfffaoysa-n}}
 
{{#set: molecular-weight=277.439}}
 

Latest revision as of 11:00, 18 March 2021

Pathway PWY-5135

  • taxonomic-range:
    • tax-3481
  • common-name:
    • xanthohumol biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-7821 RXN-7821]
  • [NoneRXN-7820 RXN-7820]