Difference between revisions of "PWY-5135"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-281 CPD-281] == * common-name: ** s-(2-methylpropanoyl)-dihydrolipoamide * smiles: ** cc(c(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12221 CPD-12221] == * common-name: ** methyl bromide * smiles: ** cbr * inchi-key: ** gzuxj...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-281 CPD-281] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12221 CPD-12221] ==
 
* common-name:
 
* common-name:
** s-(2-methylpropanoyl)-dihydrolipoamide
+
** methyl bromide
 
* smiles:
 
* smiles:
** cc(c(sc(ccccc(n)=o)ccs)=o)c
+
** cbr
 
* inchi-key:
 
* inchi-key:
** xzukurpvwdtxge-uhfffaoysa-n
+
** gzuxjhmpeanegy-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 277.439
+
** 94.939
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DHRT_LPAREN_ibcoa_RPAREN_]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-11268]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-(2-methylpropanoyl)-dihydrolipoamide}}
+
{{#set: common-name=methyl bromide}}
{{#set: inchi-key=inchikey=xzukurpvwdtxge-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=gzuxjhmpeanegy-uhfffaoysa-n}}
{{#set: molecular-weight=277.439}}
+
{{#set: molecular-weight=94.939}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-12221

  • common-name:
    • methyl bromide
  • smiles:
    • cbr
  • inchi-key:
    • gzuxjhmpeanegy-uhfffaoysa-n
  • molecular-weight:
    • 94.939

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality