Difference between revisions of "PWY-5136"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14757 CPD-14757] == * common-name: ** methylphenylsulfide * smiles: ** csc1(=cc=cc=c1) * in...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-729 CPD-729] == * common-name: ** 12-oxo-cis-10,15-phytodienoate * smiles: ** ccc=ccc1(c(c=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14757 CPD-14757] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-729 CPD-729] ==
 
* common-name:
 
* common-name:
** methylphenylsulfide
+
** 12-oxo-cis-10,15-phytodienoate
 
* smiles:
 
* smiles:
** csc1(=cc=cc=c1)
+
** ccc=ccc1(c(c=cc(=o)1)cccccccc([o-])=o)
 
* inchi-key:
 
* inchi-key:
** hnkjadcvzubcpg-uhfffaoysa-n
+
** pmtmafaplcgxgk-jmtmcxqrsa-m
 
* molecular-weight:
 
* molecular-weight:
** 124.2
+
** 291.409
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[12-OXOPHYTODIENOATE-REDUCTASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13726]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=methylphenylsulfide}}
+
{{#set: common-name=12-oxo-cis-10,15-phytodienoate}}
{{#set: inchi-key=inchikey=hnkjadcvzubcpg-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=pmtmafaplcgxgk-jmtmcxqrsa-m}}
{{#set: molecular-weight=124.2}}
+
{{#set: molecular-weight=291.409}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-729

  • common-name:
    • 12-oxo-cis-10,15-phytodienoate
  • smiles:
    • ccc=ccc1(c(c=cc(=o)1)cccccccc([o-])=o)
  • inchi-key:
    • pmtmafaplcgxgk-jmtmcxqrsa-m
  • molecular-weight:
    • 291.409

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality