Difference between revisions of "PWY-5136"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-729 CPD-729] == * common-name: ** 12-oxo-cis-10,15-phytodienoate * smiles: ** ccc=ccc1(c(c=...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23S-rRNA-guanine-2445 23S-rRNA-guanine-2445] == * common-name: ** a guanine2445 in 23s rrna ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-729 CPD-729] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23S-rRNA-guanine-2445 23S-rRNA-guanine-2445] ==
 
* common-name:
 
* common-name:
** 12-oxo-cis-10,15-phytodienoate
+
** a guanine2445 in 23s rrna
* smiles:
 
** ccc=ccc1(c(c=cc(=o)1)cccccccc([o-])=o)
 
* inchi-key:
 
** pmtmafaplcgxgk-jmtmcxqrsa-m
 
* molecular-weight:
 
** 291.409
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[12-OXOPHYTODIENOATE-REDUCTASE-RXN]]
+
* [[RXN-11574]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=12-oxo-cis-10,15-phytodienoate}}
+
{{#set: common-name=a guanine2445 in 23s rrna}}
{{#set: inchi-key=inchikey=pmtmafaplcgxgk-jmtmcxqrsa-m}}
 
{{#set: molecular-weight=291.409}}
 

Revision as of 09:22, 27 August 2019

Metabolite 23S-rRNA-guanine-2445

  • common-name:
    • a guanine2445 in 23s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality