Difference between revisions of "PWY-5754"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOPENTAOSE MALTOPENTAOSE] ==
+== Pathway PWY-7666 ==
+* taxonomic-range:
+** tax-1117
 * common-name:
-** maltopentaose
+** galactolipid biosynthesis ii
-* smiles:
+== Reaction(s) found ==
-** c(c5(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co))co))c(c4o)o)co))c(c(c5o)o)o))o
+* [[RXN-1225]]
-* inchi-key:
+== Reaction(s) not found ==
-** ftnipwxxignqqf-hzwihctqsa-n
+* [NoneRXN-16647 RXN-16647]
-* molecular-weight:
+* [NoneRXN-16648 RXN-16648]
-** 828.725
+{{#set: taxonomic-range=tax-1117}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=galactolipid biosynthesis ii}}
-* [[RXN-14281]]
+{{#set: nb reaction found=1}}
-* [[RXN-14284]]
+{{#set: completion rate=0.33}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb total reaction=3}}
-* [[RXN-14282]]
-* [[RXN-14285]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=maltopentaose}}
-{{#set: inchi-key=inchikey=ftnipwxxignqqf-hzwihctqsa-n}}
-{{#set: molecular-weight=828.725}}