Difference between revisions of "PWY-6075"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE] == * common-name...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Glycerol-1-phosphate Glycerol-1-phosphate] == * common-name: ** glycerol 1-phosphate == Reactio...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Glycerol-1-phosphate Glycerol-1-phosphate] ==
 
* common-name:
 
* common-name:
** s-adenosyl-4-methylthio-2-oxobutanoate
+
** glycerol 1-phosphate
* smiles:
 
** c[s+](ccc(c([o-])=o)=o)cc1(oc(c(c1o)o)n3(c2(=nc=nc(=c2n=c3)n)))
 
* inchi-key:
 
** uokvqqmbgvmxpu-cjpdyehrsa-n
 
* molecular-weight:
 
** 397.405
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DAPASYN-RXN]]
+
* [[GLYCEROL-1-PHOSPHATASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DAPASYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-adenosyl-4-methylthio-2-oxobutanoate}}
+
{{#set: common-name=glycerol 1-phosphate}}
{{#set: inchi-key=inchikey=uokvqqmbgvmxpu-cjpdyehrsa-n}}
 
{{#set: molecular-weight=397.405}}
 

Revision as of 14:18, 26 August 2019

Metabolite Glycerol-1-phosphate

  • common-name:
    • glycerol 1-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality