Difference between revisions of "PWY-6673"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NOREPINEPHRINE NOREPINEPHRINE] ==
+== Pathway PWY-6673 ==
+* taxonomic-range:
+** tax-33090
 * common-name:
-** (r)-noradrenaline
+** caffeoylglucarate biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c1(c=c(o)c(=cc=1c(c[n+])o)o)
+* [[RXN-1126]]
-* inchi-key:
+== Reaction(s) not found ==
-** sflshlfxelfnjz-qmmmgpobsa-o
+* [None2.3.1.98-RXN 2.3.1.98-RXN]
-* molecular-weight:
+* [NoneRXN-2622 RXN-2622]
-** 170.188
+{{#set: taxonomic-range=tax-33090}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=caffeoylglucarate biosynthesis}}
-* [[RXN-10907]]
+{{#set: nb reaction found=1}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.33}}
-* [[DOPAMINE-BETA-MONOOXYGENASE-RXN]]
+{{#set: nb total reaction=3}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=(r)-noradrenaline}}
-{{#set: inchi-key=inchikey=sflshlfxelfnjz-qmmmgpobsa-o}}
-{{#set: molecular-weight=170.188}}