Difference between revisions of "PWY-6673"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=R-3-hydroxyhexanoyl-ACPs R-3-hydroxyhexanoyl-ACPs] == * common-name: ** a (3r)-3-hydroxyhexanoy...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10792 CPD-10792] == * common-name: ** 2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate * smiles...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10792 CPD-10792] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate |
| + | * smiles: | ||
| + | ** cc(=o)c(o)c(o)cc([n+])c([o-])=o | ||
| + | * inchi-key: | ||
| + | ** ifmhgoadxgywmo-kvqbguixsa-n | ||
| + | * molecular-weight: | ||
| + | ** 191.183 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-10032]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate}} |
| + | {{#set: inchi-key=inchikey=ifmhgoadxgywmo-kvqbguixsa-n}} | ||
| + | {{#set: molecular-weight=191.183}} | ||
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-10792
- common-name:
- 2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate
- smiles:
- cc(=o)c(o)c(o)cc([n+])c([o-])=o
- inchi-key:
- ifmhgoadxgywmo-kvqbguixsa-n
- molecular-weight:
- 191.183
