Difference between revisions of "PWY-6730"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-667 CPD-667] == * common-name: ** o-acetyl-l-homoserine * smiles: ** cc(occc(c([o-])=o)[n+]...")
 
(Created page with "Category:pathway == Pathway PWY-6730 == * taxonomic-range: ** tax-131567 ** tax-33090 * common-name: ** methylhalides biosynthesis (plants) == Reaction(s) found == * RXN...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-667 CPD-667] ==
+
== Pathway PWY-6730 ==
 +
* taxonomic-range:
 +
** tax-131567
 +
** tax-33090
 
* common-name:
 
* common-name:
** o-acetyl-l-homoserine
+
** methylhalides biosynthesis (plants)
* smiles:
+
== Reaction(s) found ==
** cc(occc(c([o-])=o)[n+])=o
+
* [[RXN-11241]]
* inchi-key:
+
* [[RXN-11267]]
** fcxzbwsiaggpcb-yfkpbyrvsa-n
+
* [[RXN-11268]]
* molecular-weight:
+
== Reaction(s) not found ==
** 161.157
+
All reactions of this pathways are in present
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-131567|tax-33090}}
* [[ACETYLHOMOSER-CYS-RXN]]
+
{{#set: common-name=methylhalides biosynthesis (plants)}}
* [[ACHMSSELCYSL]]
+
{{#set: nb reaction found=3}}
* [[ACHMSSELCYSLh]]
+
{{#set: completion rate=1.0}}
* [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]]
+
{{#set: nb total reaction=3}}
== Reaction(s) known to produce the compound ==
 
* [[ACETYLHOMOSER-CYS-RXN]]
 
* [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=o-acetyl-l-homoserine}}
 
{{#set: inchi-key=inchikey=fcxzbwsiaggpcb-yfkpbyrvsa-n}}
 
{{#set: molecular-weight=161.157}}
 

Latest revision as of 10:59, 18 March 2021

Pathway PWY-6730

  • taxonomic-range:
    • tax-131567
    • tax-33090
  • common-name:
    • methylhalides biosynthesis (plants)

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present