Difference between revisions of "PWY-6730"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-667 CPD-667] == * common-name: ** o-acetyl-l-homoserine * smiles: ** cc(occc(c([o-])=o)[n+]...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS CYS] == * common-name: ** l-cysteine * smiles: ** c(s)c(c(=o)[o-])[n+] * inchi-key: ** xujn...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-667 CPD-667] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS CYS] ==
 
* common-name:
 
* common-name:
** o-acetyl-l-homoserine
+
** l-cysteine
 
* smiles:
 
* smiles:
** cc(occc(c([o-])=o)[n+])=o
+
** c(s)c(c(=o)[o-])[n+]
 
* inchi-key:
 
* inchi-key:
** fcxzbwsiaggpcb-yfkpbyrvsa-n
+
** xujnekjlayxesh-reohclbhsa-n
 
* molecular-weight:
 
* molecular-weight:
** 161.157
+
** 121.154
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACETYLHOMOSER-CYS-RXN]]
+
* [[ACSERLY-RXN]]
* [[ACHMSSELCYSL]]
+
* [[CYSPH-RXN]]
* [[ACHMSSELCYSLh]]
+
* [[CYSTATHIONASE-RXN]]
* [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]]
+
* [[CYSTEINE--TRNA-LIGASE-RXN]]
 +
* [[CYSTEINE-AMINOTRANSFERASE-RXN]]
 +
* [[CYSTEINE-DIOXYGENASE-RXN]]
 +
* [[GLUTCYSLIG-RXN]]
 +
* [[LCYSDESULF-RXN]]
 +
* [[O-SUCCHOMOSERLYASE-RXN]]
 +
* [[P-PANTOCYSLIG-RXN]]
 +
* [[RXN-12588]]
 +
* [[RXN-14385]]
 +
* [[RXN-15129]]
 +
* [[RXN-15881]]
 +
* [[RXN-8351]]
 +
* [[RXN-9787]]
 +
* [[RXN0-308]]
 +
* [[RXN1G-121]]
 +
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACETYLHOMOSER-CYS-RXN]]
+
* [[1.8.3.5-RXN]]
* [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]]
+
* [[ACSERLY-RXN]]
 +
* [[CYSTATHIONASE-RXN]]
 +
* [[CYSTEINE-AMINOTRANSFERASE-RXN]]
 +
* [[O-SUCCHOMOSERLYASE-RXN]]
 +
* [[RXN-11623]]
 +
* [[RXN-14048]]
 +
* [[RXN-15130]]
 +
* [[RXN-16637]]
 +
* [[RXN-6622]]
 +
* [[RXN-9787]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=o-acetyl-l-homoserine}}
+
{{#set: common-name=l-cysteine}}
{{#set: inchi-key=inchikey=fcxzbwsiaggpcb-yfkpbyrvsa-n}}
+
{{#set: inchi-key=inchikey=xujnekjlayxesh-reohclbhsa-n}}
{{#set: molecular-weight=161.157}}
+
{{#set: molecular-weight=121.154}}

Revision as of 14:19, 26 August 2019