Difference between revisions of "PWY-6792"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15153 CPD-15153] ==
+== Pathway PWY-6792 ==
+* taxonomic-range:
+** tax-33090
 * common-name:
-** 3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone
+** scopoletin biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(=o)c(oc)=cc(=o)c(c)=1)
+* [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** flybtlrocqbhmr-kfsstaeesa-n
+* [NoneRXN-12350 RXN-12350]
-* molecular-weight:
+* [NoneRXN-12349 RXN-12349]
-** 697.095
+{{#set: taxonomic-range=tax-33090}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=scopoletin biosynthesis}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=1}}
-* [[RXN-14177]]
+{{#set: completion rate=0.33}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=3}}
-{{#set: common-name=3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone}}
-{{#set: inchi-key=inchikey=flybtlrocqbhmr-kfsstaeesa-n}}
-{{#set: molecular-weight=697.095}}