Difference between revisions of "PWY-6792"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15153 CPD-15153] ==
+== Pathway PWY-6873 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** 3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone
+** long chain fatty acid ester synthesis (engineered)
-* smiles:
+== Reaction(s) found ==
-** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(=o)c(oc)=cc(=o)c(c)=1)
+* [[RXN-12639]]
-* inchi-key:
+* [[RXN-7904]]
-** flybtlrocqbhmr-kfsstaeesa-n
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-11039 RXN-11039]
-** 697.095
+* [NoneRXN-6161 RXN-6161]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-2}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=long chain fatty acid ester synthesis (engineered)}}
-* [[RXN-14177]]
+{{#set: nb reaction found=2}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.5}}
-{{#set: common-name=3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone}}
+{{#set: nb total reaction=4}}
-{{#set: inchi-key=inchikey=flybtlrocqbhmr-kfsstaeesa-n}}
-{{#set: molecular-weight=697.095}}