Difference between revisions of "PWY-6825"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD3O-4151 CPD3O-4151] == * common-name: ** 4-tyrosol * smiles: ** c1(c(=cc=c(c=1)o)cco) * inch...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-510 CPD-510] == * common-name: ** α-d-glucuronate 1-phosphate * smiles: ** c(c1(oc(c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD3O-4151 CPD3O-4151] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-510 CPD-510] ==
 
* common-name:
 
* common-name:
** 4-tyrosol
+
** α-d-glucuronate 1-phosphate
 
* smiles:
 
* smiles:
** c1(c(=cc=c(c=1)o)cco)
+
** c(c1(oc(c(c(c1o)o)o)op([o-])([o-])=o))([o-])=o
 
* inchi-key:
 
* inchi-key:
** yccilvskpbxvip-uhfffaoysa-n
+
** aiqdykmwenwvqj-qiuujyrfsa-k
 
* molecular-weight:
 
* molecular-weight:
** 138.166
+
** 271.097
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.7.7.44-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN3O-4113]]
+
* [[2.7.7.44-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-tyrosol}}
+
{{#set: common-name=α-d-glucuronate 1-phosphate}}
{{#set: inchi-key=inchikey=yccilvskpbxvip-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=aiqdykmwenwvqj-qiuujyrfsa-k}}
{{#set: molecular-weight=138.166}}
+
{{#set: molecular-weight=271.097}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-510

  • common-name:
    • α-d-glucuronate 1-phosphate
  • smiles:
    • c(c1(oc(c(c(c1o)o)o)op([o-])([o-])=o))([o-])=o
  • inchi-key:
    • aiqdykmwenwvqj-qiuujyrfsa-k
  • molecular-weight:
    • 271.097

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality