Difference between revisions of "PWY-6920"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE-PYROPHOSPHATE THIAMINE-PYROPHOSPHATE] == * common-name: ** thiamine diphosphate * smil...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13930 CPD-13930] == * common-name: ** (z)-2-methyl-peroxyaminoacrylate * smiles: ** cc(=cn)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE-PYROPHOSPHATE THIAMINE-PYROPHOSPHATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13930 CPD-13930] ==
 
* common-name:
 
* common-name:
** thiamine diphosphate
+
** (z)-2-methyl-peroxyaminoacrylate
 
* smiles:
 
* smiles:
** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
+
** cc(=cn)c(=o)oo
 
* inchi-key:
 
* inchi-key:
** ayekofbpnlcajy-uhfffaoysa-l
+
** dyysamfojrgamq-ihwypqmzsa-n
 
* molecular-weight:
 
* molecular-weight:
** 422.288
+
** 117.104
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12583]]
 
* [[RXN-14037]]
 
* [[RXN0-3542]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PDHam2hi]]
+
* [[RXN-12895]]
* [[PDHam2mi]]
+
* [[RXN-12896]]
* [[RXN-12508]]
 
* [[RXN-14037]]
 
* [[RXN0-3542]]
 
* [[THIAMIN-PYROPHOSPHOKINASE-RXN]]
 
* [[THIAMIN-TRIPHOSPHATASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=thiamine diphosphate}}
+
{{#set: common-name=(z)-2-methyl-peroxyaminoacrylate}}
{{#set: inchi-key=inchikey=ayekofbpnlcajy-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=dyysamfojrgamq-ihwypqmzsa-n}}
{{#set: molecular-weight=422.288}}
+
{{#set: molecular-weight=117.104}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-13930

  • common-name:
    • (z)-2-methyl-peroxyaminoacrylate
  • smiles:
    • cc(=cn)c(=o)oo
  • inchi-key:
    • dyysamfojrgamq-ihwypqmzsa-n
  • molecular-weight:
    • 117.104

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality