Difference between revisions of "PWY-7046"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxidized-2Fe-2S-Ferredoxins Oxidized-2Fe-2S-Ferredoxins] == * common-name: ** an oxidized [2fe-...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE 2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE] == * common-name: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxidized-2Fe-2S-Ferredoxins Oxidized-2Fe-2S-Ferredoxins] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE 2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE] ==
 
* common-name:
 
* common-name:
** an oxidized [2fe-2s] ferredoxin
+
** 2-carboxy-d-arabinitol 1-phosphate
 +
* smiles:
 +
** c(c(c(c(cop([o-])([o-])=o)(c([o-])=o)o)o)o)o
 +
* inchi-key:
 +
** ujtmirnfexkgms-uhfffaoysa-k
 +
* molecular-weight:
 +
** 273.113
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.8.1.6-RXN]]
 
* [[RXN-11586]]
 
* [[RXN-14950]]
 
* [[RXN-14957]]
 
* [[RXN-14959]]
 
* [[RXN-17472]]
 
* [[RXN0-949]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an oxidized [2fe-2s] ferredoxin}}
+
{{#set: common-name=2-carboxy-d-arabinitol 1-phosphate}}
 +
{{#set: inchi-key=inchikey=ujtmirnfexkgms-uhfffaoysa-k}}
 +
{{#set: molecular-weight=273.113}}

Revision as of 14:18, 26 August 2019

Metabolite 2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE

  • common-name:
    • 2-carboxy-d-arabinitol 1-phosphate
  • smiles:
    • c(c(c(c(cop([o-])([o-])=o)(c([o-])=o)o)o)o)o
  • inchi-key:
    • ujtmirnfexkgms-uhfffaoysa-k
  • molecular-weight:
    • 273.113

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality