Difference between revisions of "PWY-7396"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-OH-4-ACETYL-2-OXOGLUTARATE 4-OH-4-ACETYL-2-OXOGLUTARATE] ==
+== Pathway PWY-7396 ==
+* taxonomic-range:
+** tax-2
+** tax-4751
 * common-name:
-** 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate
+** butanol and isobutanol biosynthesis (engineered)
-* smiles:
+== Reaction(s) found ==
-** c(c(cc(o)(cc(=o)[o-])c(=o)[o-])=o)(=o)[o-]
+* [[1.4.3.19-RXN]]
-* inchi-key:
+* [[RXN-14986]]
-** rqmcndrmpzbeod-uhfffaoysa-k
+* [[RXN-161]]
-* molecular-weight:
+* [[RXN-7657]]
-** 217.112
+== Reaction(s) not found ==
-== Reaction(s) known to consume the compound ==
+* [None3-ETHYLMALATE-SYNTHASE-RXN 3-ETHYLMALATE-SYNTHASE-RXN]
-* [[RXN-2464]]
+* [NoneRXN-7643 RXN-7643]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-14984 RXN-14984]
-* [[RXN-2464]]
+* [NoneRXN-14985 RXN-14985]
-== Reaction(s) of unknown directionality ==
+{{#set: taxonomic-range=tax-4751|tax-2}}
-{{#set: common-name=2-hydroxy-4-oxobutane-1,2,4-tricarboxylate}}
+{{#set: common-name=butanol and isobutanol biosynthesis (engineered)}}
-{{#set: inchi-key=inchikey=rqmcndrmpzbeod-uhfffaoysa-k}}
+{{#set: nb reaction found=4}}
-{{#set: molecular-weight=217.112}}
+{{#set: completion rate=0.5}}
+{{#set: nb total reaction=8}}