Difference between revisions of "PWY-7396"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3725 CPD-3725] == * common-name: ** uridine 2'3'-cyclic monophosphate * smiles: ** c1(=cn(c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLN-tRNAs GLN-tRNAs] == * common-name: ** a trnagln == Reaction(s) known to consume the compoun...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3725 CPD-3725] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLN-tRNAs GLN-tRNAs] ==
 
* common-name:
 
* common-name:
** uridine 2'3'-cyclic monophosphate
+
** a trnagln
* smiles:
 
** c1(=cn(c(=o)nc(=o)1)c3(oc(co)c2(op(=o)([o-])oc23)))
 
* inchi-key:
 
** hwdmhjdymfrxox-xvfcmesisa-m
 
* molecular-weight:
 
** 305.16
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12060]]
+
* [[GLUTAMINE--TRNA-LIGASE-RXN]]
 +
* [[RXN-9386]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=uridine 2'3'-cyclic monophosphate}}
+
{{#set: common-name=a trnagln}}
{{#set: inchi-key=inchikey=hwdmhjdymfrxox-xvfcmesisa-m}}
 
{{#set: molecular-weight=305.16}}
 

Revision as of 09:22, 27 August 2019

Metabolite GLN-tRNAs

  • common-name:
    • a trnagln

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality