Difference between revisions of "PWY-7397"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-207 CPD-207] == * common-name: ** phenylacetyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccs...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=B-KETOACYL-ACP B-KETOACYL-ACP] == * common-name: ** a 3-oxoacyl-[acp] == Reaction(s) known to c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-207 CPD-207] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=B-KETOACYL-ACP B-KETOACYL-ACP] ==
 
* common-name:
 
* common-name:
** phenylacetyl-coa
+
** a 3-oxoacyl-[acp]
* smiles:
 
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc1(c=cc=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
* inchi-key:
 
** zigifdrjfzyeeq-cecatxlmsa-j
 
* molecular-weight:
 
** 881.637
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10821]]
+
* [[2.3.1.41-RXN]]
 +
* [[3-OXOACYL-ACP-REDUCT-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.3.1.41-RXN]]
 +
* [[3-OXOACYL-ACP-SYNTH-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phenylacetyl-coa}}
+
{{#set: common-name=a 3-oxoacyl-[acp]}}
{{#set: inchi-key=inchikey=zigifdrjfzyeeq-cecatxlmsa-j}}
 
{{#set: molecular-weight=881.637}}
 

Revision as of 09:22, 27 August 2019

Metabolite B-KETOACYL-ACP

  • common-name:
    • a 3-oxoacyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 3-oxoacyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.