Difference between revisions of "PWY-7736"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-PHOSPHO-RIBOSYL-GLYCINEAMIDE 5-PHOSPHO-RIBOSYL-GLYCINEAMIDE] ==
+== Pathway PWY-7736 ==
+* taxonomic-range:
+** tax-4751
 * common-name:
-** n1-(5-phospho-&beta;-d-ribosyl)glycinamide
+** stellatic acid biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c([n+])c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
+* [[FARNESYLTRANSTRANSFERASE-RXN]]
-* inchi-key:
+* [[FPPSYN-RXN]]
-** obqmlsfouzuiob-shuuezrqsa-m
+* [[GPPSYN-RXN]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 285.17
+* [NoneRXN-17163 RXN-17163]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-17162 RXN-17162]
-* [[FPGFTh]]
+* [NoneRXN-17161 RXN-17161]
-* [[GART-RXN]]
+* [NoneRXN-8813 RXN-8813]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-17164 RXN-17164]
-* [[FGFTh]]
+{{#set: taxonomic-range=tax-4751}}
-* [[FPGFTh]]
+{{#set: common-name=stellatic acid biosynthesis}}
-* [[GART-RXN]]
+{{#set: nb reaction found=3}}
-* [[GLYRIBONUCSYN-RXN]]
+{{#set: completion rate=0.38}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=8}}
-{{#set: common-name=n1-(5-phospho-&beta;-d-ribosyl)glycinamide}}
-{{#set: inchi-key=inchikey=obqmlsfouzuiob-shuuezrqsa-m}}
-{{#set: molecular-weight=285.17}}