Difference between revisions of "PWY-782"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] == * common-name: ** β-d-glucose 6-phosphate * smiles: ** c(c1(oc(c(c(c1o...")
(Created page with "Category:pathway == Pathway PWY-782 == * taxonomic-range: ** tax-33090 * common-name: ** glycolipid desaturation == Reaction(s) found == * RXN-8295 * RXN-8297 * ...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] ==
+
== Pathway PWY-782 ==
 +
* taxonomic-range:
 +
** tax-33090
 
* common-name:
 
* common-name:
** β-d-glucose 6-phosphate
+
** glycolipid desaturation
* smiles:
+
== Reaction(s) found ==
** c(c1(oc(c(c(c1o)o)o)o))op([o-])([o-])=o
+
* [[RXN-8295]]
* inchi-key:
+
* [[RXN-8297]]
** nbschqhzlsjfnq-vfuothlcsa-l
+
* [[RXN-8299]]
* molecular-weight:
+
* [[RXN-8301]]
** 258.121
+
* [[RXN-8303]]
== Reaction(s) known to consume the compound ==
+
* [[RXN-8306]]
* [[G6PBDH]]
+
* [[RXN-8309]]
* [[G6PBDHh]]
+
* [[RXN-8310]]
* [[G6PI]]
+
* [[RXN-8311]]
* [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]]
+
* [[RXN-8313]]
* [[PGIB]]
+
* [[RXN-8314]]
* [[PGIBh]]
+
* [[RXN-8364]]
* [[RXN66-579]]
+
* [[RXN-8365]]
== Reaction(s) known to produce the compound ==
+
* [[RXN-8366]]
* [[G6PI]]
+
* [[RXN-8367]]
* [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]]
+
* [[RXN-8368]]
* [[PGIB]]
+
== Reaction(s) not found ==
* [[PGIBh]]
+
* [NoneRXN-8304 RXN-8304]
== Reaction(s) of unknown directionality ==
+
* [NoneRXN-8308 RXN-8308]
{{#set: common-name=β-d-glucose 6-phosphate}}
+
* [NoneRXN-8307 RXN-8307]
{{#set: inchi-key=inchikey=nbschqhzlsjfnq-vfuothlcsa-l}}
+
* [NoneRXN-8296 RXN-8296]
{{#set: molecular-weight=258.121}}
+
* [NoneRXN-8369 RXN-8369]
 +
* [NoneRXN-1728 RXN-1728]
 +
* [NoneRXN-8300 RXN-8300]
 +
* [NoneRXN-8298 RXN-8298]
 +
* [NoneRXN-8305 RXN-8305]
 +
* [NoneRXN-8302 RXN-8302]
 +
* [NoneRXN-8363 RXN-8363]
 +
* [NoneRXN-8294 RXN-8294]
 +
{{#set: taxonomic-range=tax-33090}}
 +
{{#set: common-name=glycolipid desaturation}}
 +
{{#set: nb reaction found=16}}
 +
{{#set: completion rate=0.57}}
 +
{{#set: nb total reaction=28}}

Latest revision as of 10:57, 18 March 2021

Pathway PWY-782

  • taxonomic-range:
    • tax-33090
  • common-name:
    • glycolipid desaturation

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-8304 RXN-8304]
  • [NoneRXN-8308 RXN-8308]
  • [NoneRXN-8307 RXN-8307]
  • [NoneRXN-8296 RXN-8296]
  • [NoneRXN-8369 RXN-8369]
  • [NoneRXN-1728 RXN-1728]
  • [NoneRXN-8300 RXN-8300]
  • [NoneRXN-8298 RXN-8298]
  • [NoneRXN-8305 RXN-8305]
  • [NoneRXN-8302 RXN-8302]
  • [NoneRXN-8363 RXN-8363]
  • [NoneRXN-8294 RXN-8294]