Difference between revisions of "PWY-7897"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11495 CPD-11495] == * common-name: ** (2-hydroxyphenyl)acetate * smiles: ** c(=o)([o-])cc1(...")
 
(Created page with "Category:pathway == Pathway PWY-7897 == * taxonomic-range: ** tax-3398 * common-name: ** flavonoid di-c-glucosylation == Reaction(s) found == * 4-COUMARATE--COA-LIGASE-R...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11495 CPD-11495] ==
+
== Pathway PWY-7897 ==
 +
* taxonomic-range:
 +
** tax-3398
 
* common-name:
 
* common-name:
** (2-hydroxyphenyl)acetate
+
** flavonoid di-c-glucosylation
* smiles:
+
== Reaction(s) found ==
** c(=o)([o-])cc1(=c(o)c=cc=c1)
+
* [[4-COUMARATE--COA-LIGASE-RXN]]
* inchi-key:
+
* [[APIGNAR-RXN]]
** ccvyrrgzdbshfu-uhfffaoysa-m
+
* [[NARINGENIN-CHALCONE-SYNTHASE-RXN]]
* molecular-weight:
+
== Reaction(s) not found ==
** 151.141
+
* [NoneRXN-18753 RXN-18753]
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-18724 RXN-18724]
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-11467 RXN-11467]
* [[RXN-10815]]
+
* [NoneRXN-11684 RXN-11684]
== Reaction(s) of unknown directionality ==
+
* [NoneRXN-11468 RXN-11468]
{{#set: common-name=(2-hydroxyphenyl)acetate}}
+
* [NoneRXN-14076 RXN-14076]
{{#set: inchi-key=inchikey=ccvyrrgzdbshfu-uhfffaoysa-m}}
+
* [NoneRXN-18730 RXN-18730]
{{#set: molecular-weight=151.141}}
+
* [NoneRXN-18727 RXN-18727]
 +
* [NoneRXN-14069 RXN-14069]
 +
* [NoneRXN-18725 RXN-18725]
 +
* [NoneRXN-11685 RXN-11685]
 +
* [NoneRXN-11686 RXN-11686]
 +
{{#set: taxonomic-range=tax-3398}}
 +
{{#set: common-name=flavonoid di-c-glucosylation}}
 +
{{#set: nb reaction found=3}}
 +
{{#set: completion rate=0.2}}
 +
{{#set: nb total reaction=15}}

Latest revision as of 10:58, 18 March 2021

Pathway PWY-7897

  • taxonomic-range:
    • tax-3398
  • common-name:
    • flavonoid di-c-glucosylation

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-18753 RXN-18753]
  • [NoneRXN-18724 RXN-18724]
  • [NoneRXN-11467 RXN-11467]
  • [NoneRXN-11684 RXN-11684]
  • [NoneRXN-11468 RXN-11468]
  • [NoneRXN-14076 RXN-14076]
  • [NoneRXN-18730 RXN-18730]
  • [NoneRXN-18727 RXN-18727]
  • [NoneRXN-14069 RXN-14069]
  • [NoneRXN-18725 RXN-18725]
  • [NoneRXN-11685 RXN-11685]
  • [NoneRXN-11686 RXN-11686]