Difference between revisions of "PWY-7897"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7036 CPD-7036] == * common-name: ** 3-methylthiopropanal * smiles: ** csccc=o * inchi-key:...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7224 CPD-7224] == * common-name: ** n-acetyl-l-citrulline * smiles: ** cc(=o)nc(c([o-])=o)c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7036 CPD-7036] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7224 CPD-7224] ==
 
* common-name:
 
* common-name:
** 3-methylthiopropanal
+
** n-acetyl-l-citrulline
 
* smiles:
 
* smiles:
** csccc=o
+
** cc(=o)nc(c([o-])=o)cccnc(=o)n
 
* inchi-key:
 
* inchi-key:
** cluwowrthnnbbu-uhfffaoysa-n
+
** wmqmioyqxnrroc-lurjtmiesa-m
 
* molecular-weight:
 
* molecular-weight:
** 104.167
+
** 216.216
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7706]]
+
* [[RXN-7933]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-methylthiopropanal}}
+
{{#set: common-name=n-acetyl-l-citrulline}}
{{#set: inchi-key=inchikey=cluwowrthnnbbu-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=wmqmioyqxnrroc-lurjtmiesa-m}}
{{#set: molecular-weight=104.167}}
+
{{#set: molecular-weight=216.216}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-7224

  • common-name:
    • n-acetyl-l-citrulline
  • smiles:
    • cc(=o)nc(c([o-])=o)cccnc(=o)n
  • inchi-key:
    • wmqmioyqxnrroc-lurjtmiesa-m
  • molecular-weight:
    • 216.216

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality