Difference between revisions of "PWY0-1296"

Revision as of 14:18, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15692 CPD-15692] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Uridine32-in-tRNA Uridine32-in-tRNA] ==
 * common-name:
-** (3e)-dec-3-enoyl-coa
+** a uridine32 in trna
-* smiles:
-** ccccccc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
-* inchi-key:
-** cqgvnmqhzqjnii-zjzqahhtsa-j
-* molecular-weight:
-** 915.738
 == Reaction(s) known to consume the compound ==
+* [[RXN-11842]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-14803]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(3e)-dec-3-enoyl-coa}}
+{{#set: common-name=a uridine32 in trna}}
-{{#set: inchi-key=inchikey=cqgvnmqhzqjnii-zjzqahhtsa-j}}
-{{#set: molecular-weight=915.738}}