Difference between revisions of "PYRIDNUCSAL-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-309 CPD-309] == * common-name: ** d-octopine * smiles: ** cc(c([o-])=o)[n+]c(c([o-])=o)cccn...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LEUCOPELARGONIDIN-CMPD LEUCOPELARGONIDIN-CMPD] == * common-name: ** (2r,3s,4s)-leucopelargonidi...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-309 CPD-309] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LEUCOPELARGONIDIN-CMPD LEUCOPELARGONIDIN-CMPD] ==
 
* common-name:
 
* common-name:
** d-octopine
+
** (2r,3s,4s)-leucopelargonidin
 
* smiles:
 
* smiles:
** cc(c([o-])=o)[n+]c(c([o-])=o)cccnc(n)=[n+]
+
** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc=c(c=3)o)
 
* inchi-key:
 
* inchi-key:
** imxsccduafeioe-ritpcoansa-n
+
** fsvmlwolzhgcqx-souvjxgzsa-n
 
* molecular-weight:
 
* molecular-weight:
** 246.266
+
** 290.272
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[D-OCTOPINE-DEHYDROGENASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.5.1.11-RXN]]
+
* [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-octopine}}
+
{{#set: common-name=(2r,3s,4s)-leucopelargonidin}}
{{#set: inchi-key=inchikey=imxsccduafeioe-ritpcoansa-n}}
+
{{#set: inchi-key=inchikey=fsvmlwolzhgcqx-souvjxgzsa-n}}
{{#set: molecular-weight=246.266}}
+
{{#set: molecular-weight=290.272}}

Revision as of 14:18, 26 August 2019

Metabolite LEUCOPELARGONIDIN-CMPD

  • common-name:
    • (2r,3s,4s)-leucopelargonidin
  • smiles:
    • c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc=c(c=3)o)
  • inchi-key:
    • fsvmlwolzhgcqx-souvjxgzsa-n
  • molecular-weight:
    • 290.272

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality