|
|
| Line 1: |
Line 1: |
| − | [[Category:gene]] | + | [[Category:metabolite]] |
| − | == Gene SJ21967 == | + | == Metabolite ADENOSINE == |
| − | * transcription-direction: | + | * common-name: |
| − | ** negative | + | ** adenosine |
| − | * right-end-position: | + | * smiles: |
| − | ** 192992 | + | ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))) |
| − | * left-end-position:
| + | * inchi-key: |
| − | ** 185854
| + | ** oirdtqyftabqoq-kqynxxcusa-n |
| − | * centisome-position:
| + | * molecular-weight: |
| − | ** 31.658325
| + | ** 267.244 |
| − | == Organism(s) associated with this gene ==
| + | == Reaction(s) known to consume the compound == |
| − | * [[S.japonica_carotenoid_curated]]
| + | * [[ADENODEAMIN-RXN]] |
| − | == Reaction(s) associated ==
| + | * [[ADENOSINE-KINASE-RXN]] |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | * [[ADENOSYLHOMOCYSTEINASE-RXN]] |
| − | * [[ADENYL-KIN-RXN]] | + | * [[ADENPHOSPHOR-RXN]] |
| − | ** Category: [[orthology]]
| + | * [[ADNK]] |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | + | * [[ADNKm]] |
| − | * [[ATCM]]
| + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[orthology]]
| + | * [[ADENOSYLHOMOCYSTEINASE-RXN]] |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| + | * [[ADENPHOSPHOR-RXN]] |
| − | * [[ATDCM]]
| + | * [[AMP-DEPHOSPHORYLATION-RXN]] |
| − | ** Category: [[orthology]]
| + | * [[AMP5N]] |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| + | == Reaction(s) of unknown directionality == |
| − | * [[CDPKIN-RXN]]
| + | {{#set: common-name=adenosine}} |
| − | ** Category: [[annotation]]
| + | {{#set: inchi-key=inchikey=oirdtqyftabqoq-kqynxxcusa-n}} |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| + | {{#set: molecular-weight=267.244}} |
| − | * [[DADPKIN-RXN]] | |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * [[DCDPKIN-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[DGDPKIN-RXN]] | |
| − | ** Category: [[annotation]] | |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[DTDPKIN-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[DUDPKIN-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[GDPKIN-RXN]] | |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[NUCLEOSIDE-DIP-KIN-RXN]] | |
| − | ** Category: [[annotation]] | |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * [[PROTEIN-KINASE-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * [[RXN-11832]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-12002]]
| |
| − | ** Category: [[annotation]] | |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-14120]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-14228]]
| |
| − | ** Category: [[annotation]] | |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-7913]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[UDPKIN-RXN]]
| |
| − | ** Category: [[annotation]] | |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) associated == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * [[PWY-7219]]
| |
| − | ** '''4''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-7205]]
| |
| − | ** '''2''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-7220]]
| |
| − | ** '''4''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-7227]]
| |
| − | ** '''2''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-7224]]
| |
| − | ** '''3''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[PWY-6545]]
| |
| − | ** '''8''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-7197]]
| |
| − | ** '''4''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY0-166]]
| |
| − | ** '''14''' reactions found over '''13''' reactions in the full pathway
| |
| − | * [[PWY-7210]]
| |
| − | ** '''8''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-7198]]
| |
| − | ** '''6''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY-7184]]
| |
| − | ** '''9''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-7222]]
| |
| − | ** '''4''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-7226]]
| |
| − | ** '''2''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-7187]]
| |
| − | ** '''6''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PPGPPMET-PWY]]
| |
| − | ** '''5''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[PWY-7221]]
| |
| − | ** '''4''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-7176]]
| |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| |
| − | </div>
| |
| − | {{#set: transcription-direction=negative}} | |
| − | {{#set: right-end-position=192992}} | |
| − | {{#set: left-end-position=185854}}
| |
| − | {{#set: centisome-position=31.658325 }} | |
| − | {{#set: organism associated=S.japonica_carotenoid_curated}}
| |
| − | {{#set: nb reaction associated=18}}
| |
| − | {{#set: nb pathway associated=17}}
| |
