Difference between revisions of "Protein-Ox-Disulfides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ADENOSINE == * common-name: ** adenosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))) * inchi-key: ** oirdtqyftabqoq-kqynxx...")
(Created page with "Category:metabolite == Metabolite THIOMORPHOLINE-3-CARBOXYLATE == * common-name: ** thiomorpholine-3-carboxylate * smiles: ** c1(scc(c([o-])=o)[n+]c1) * inchi-key: ** joki...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ADENOSINE ==
+
== Metabolite THIOMORPHOLINE-3-CARBOXYLATE ==
 
* common-name:
 
* common-name:
** adenosine
+
** thiomorpholine-3-carboxylate
 
* smiles:
 
* smiles:
** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23)))
+
** c1(scc(c([o-])=o)[n+]c1)
 
* inchi-key:
 
* inchi-key:
** oirdtqyftabqoq-kqynxxcusa-n
+
** jokiqgqokxghdv-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 267.244
+
** 147.192
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ADENODEAMIN-RXN]]
 
* [[ADENOSINE-KINASE-RXN]]
 
* [[ADENOSYLHOMOCYSTEINASE-RXN]]
 
* [[ADENPHOSPHOR-RXN]]
 
* [[ADNK]]
 
* [[ADNKm]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ADENOSYLHOMOCYSTEINASE-RXN]]
+
* [[1.5.1.25-RXN]]
* [[ADENPHOSPHOR-RXN]]
 
* [[AMP-DEPHOSPHORYLATION-RXN]]
 
* [[AMP5N]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=adenosine}}
+
{{#set: common-name=thiomorpholine-3-carboxylate}}
{{#set: inchi-key=inchikey=oirdtqyftabqoq-kqynxxcusa-n}}
+
{{#set: inchi-key=inchikey=jokiqgqokxghdv-uhfffaoysa-n}}
{{#set: molecular-weight=267.244}}
+
{{#set: molecular-weight=147.192}}

Revision as of 14:53, 5 January 2021

Metabolite THIOMORPHOLINE-3-CARBOXYLATE

  • common-name:
    • thiomorpholine-3-carboxylate
  • smiles:
    • c1(scc(c([o-])=o)[n+]c1)
  • inchi-key:
    • jokiqgqokxghdv-uhfffaoysa-n
  • molecular-weight:
    • 147.192

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality