Difference between revisions of "Protein-Ox-Disulfides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ADENYLOSUCC == * common-name: ** adenylo-succinate * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=nc=nc=23)nc(cc(=o)[o-])c(=...")
(Created page with "Category:metabolite == Metabolite UDP-sugar == * common-name: ** a udp-sugar == Reaction(s) known to consume the compound == * 2.7.7.64-RXN == Reaction(s) known to pro...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ADENYLOSUCC ==
+
== Metabolite UDP-sugar ==
 
* common-name:
 
* common-name:
** adenylo-succinate
+
** a udp-sugar
* smiles:
 
** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=nc=nc=23)nc(cc(=o)[o-])c(=o)[o-])))
 
* inchi-key:
 
** ofbhppmpbojxrt-dpxqiynjsa-j
 
* molecular-weight:
 
** 459.265
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[AAL_LPAREN_fum_RPAREN_]]
+
* [[2.7.7.64-RXN]]
* [[AMPSYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
+
* [[2.7.7.64-RXN]]
* [[AMPSYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=adenylo-succinate}}
+
{{#set: common-name=a udp-sugar}}
{{#set: inchi-key=inchikey=ofbhppmpbojxrt-dpxqiynjsa-j}}
 
{{#set: molecular-weight=459.265}}
 

Revision as of 18:53, 14 January 2021

Metabolite UDP-sugar

  • common-name:
    • a udp-sugar

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality