Difference between revisions of "S-ACETYLDIHYDROLIPOAMIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9858 == * common-name: ** 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cc...")
(Created page with "Category:metabolite == Metabolite S-ACETYLDIHYDROLIPOAMIDE == * common-name: ** s-acetyldihydrolipoamide * smiles: ** cc(sc(ccs)ccccc(n)=o)=o * inchi-key: ** argxexvchmnaq...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9858 ==
+
== Metabolite S-ACETYLDIHYDROLIPOAMIDE ==
 
* common-name:
 
* common-name:
** 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol
+
** s-acetyldihydrolipoamide
 
* smiles:
 
* smiles:
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c
+
** cc(sc(ccs)ccccc(n)=o)=o
 
* inchi-key:
 
* inchi-key:
** wegxyvfdoluulo-tuumqracsa-n
+
** argxexvchmnaqu-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 616.966
+
** 249.386
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9227]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[DIHYDLIPACETRANS-RXN]]
 +
* [[PDHam2hi]]
 +
* [[PDHam2mi]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol}}
+
{{#set: common-name=s-acetyldihydrolipoamide}}
{{#set: inchi-key=inchikey=wegxyvfdoluulo-tuumqracsa-n}}
+
{{#set: inchi-key=inchikey=argxexvchmnaqu-uhfffaoysa-n}}
{{#set: molecular-weight=616.966}}
+
{{#set: molecular-weight=249.386}}

Latest revision as of 11:14, 18 March 2021

Metabolite S-ACETYLDIHYDROLIPOAMIDE

  • common-name:
    • s-acetyldihydrolipoamide
  • smiles:
    • cc(sc(ccs)ccccc(n)=o)=o
  • inchi-key:
    • argxexvchmnaqu-uhfffaoysa-n
  • molecular-weight:
    • 249.386

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality