Difference between revisions of "S-ACETYLDIHYDROLIPOAMIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9858 == * common-name: ** 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cc...")
(Created page with "Category:metabolite == Metabolite tRNA-with-7-aminomethyl-7-deazaguanine == * common-name: ** a 7-aminomethyl-7-deazaguanosine34 in trna == Reaction(s) known to consume th...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9858 ==
+
== Metabolite tRNA-with-7-aminomethyl-7-deazaguanine ==
 
* common-name:
 
* common-name:
** 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol
+
** a 7-aminomethyl-7-deazaguanosine34 in trna
* smiles:
 
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c
 
* inchi-key:
 
** wegxyvfdoluulo-tuumqracsa-n
 
* molecular-weight:
 
** 616.966
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9227]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN0-1321]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol}}
+
{{#set: common-name=a 7-aminomethyl-7-deazaguanosine34 in trna}}
{{#set: inchi-key=inchikey=wegxyvfdoluulo-tuumqracsa-n}}
 
{{#set: molecular-weight=616.966}}
 

Revision as of 13:10, 14 January 2021

Metabolite tRNA-with-7-aminomethyl-7-deazaguanine

  • common-name:
    • a 7-aminomethyl-7-deazaguanosine34 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality