Difference between revisions of "S-ACETYLDIHYDROLIPOAMIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CANAVANINOSUCCINATE == * common-name: ** canavaninosuccinate * smiles: ** c(onc(=[n+])nc(cc(=o)[o-])c(=o)[o-])cc([n+])c([o-])=o * inchi-k...") |
(Created page with "Category:metabolite == Metabolite Protein-L-lysine == * common-name: ** a [protein]-l-lysine == Reaction(s) known to consume the compound == * RXN-15560 * [[RXN-15561]...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Protein-L-lysine == |
* common-name: | * common-name: | ||
− | ** | + | ** a [protein]-l-lysine |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-15560]] |
+ | * [[RXN-15561]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[3.4.19.12-RXN]] |
+ | * [[RXN-13186]] | ||
+ | * [[RXN-8661]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a [protein]-l-lysine}} |
− | |||
− |
Revision as of 11:15, 15 January 2021
Contents
Metabolite Protein-L-lysine
- common-name:
- a [protein]-l-lysine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [protein]-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.