Difference between revisions of "S-ACETYLDIHYDROLIPOAMIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-409 == * common-name: ** a 2-acylglycerol == Reaction(s) known to consume the compound == * 2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN...")
(Created page with "Category:metabolite == Metabolite CPD-9858 == * common-name: ** 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-409 ==
+
== Metabolite CPD-9858 ==
 
* common-name:
 
* common-name:
** a 2-acylglycerol
+
** 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol
 +
* smiles:
 +
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c
 +
* inchi-key:
 +
** wegxyvfdoluulo-tuumqracsa-n
 +
* molecular-weight:
 +
** 616.966
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]]
+
* [[RXN-9227]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 2-acylglycerol}}
+
{{#set: common-name=2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol}}
 +
{{#set: inchi-key=inchikey=wegxyvfdoluulo-tuumqracsa-n}}
 +
{{#set: molecular-weight=616.966}}

Revision as of 15:27, 5 January 2021

Metabolite CPD-9858

  • common-name:
    • 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol
  • smiles:
    • cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c
  • inchi-key:
    • wegxyvfdoluulo-tuumqracsa-n
  • molecular-weight:
    • 616.966

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality