Difference between revisions of "SJ01689"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8076 CPD-8076] == * common-name: ** 1-18:3-2-16:1-monogalactosyldiacylglycerol * smiles: **...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Adenine-58 tRNA-Adenine-58] == * common-name: ** an adenine58 in trna == Reaction(s) known...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8076 CPD-8076] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Adenine-58 tRNA-Adenine-58] ==
 
* common-name:
 
* common-name:
** 1-18:3-2-16:1-monogalactosyldiacylglycerol
+
** an adenine58 in trna
* smiles:
 
** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccccccccc)=o)=o
 
* inchi-key:
 
** syspljxkzrpipm-lwnbrhqxsa-n
 
* molecular-weight:
 
** 751.052
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12466]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8297]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:3-2-16:1-monogalactosyldiacylglycerol}}
+
{{#set: common-name=an adenine58 in trna}}
{{#set: inchi-key=inchikey=syspljxkzrpipm-lwnbrhqxsa-n}}
 
{{#set: molecular-weight=751.052}}
 

Revision as of 09:23, 27 August 2019

Metabolite tRNA-Adenine-58

  • common-name:
    • an adenine58 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality