Difference between revisions of "SJ03005"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Reduced-ferredoxins Reduced-ferredoxins] == * common-name: ** a reduced ferredoxin [iron-sulfur...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-253 CPD-253] == * common-name: ** 4,5-seco-dopa * smiles: ** c(=o)c=c(cc([n+])c(=o)[o-])c=c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Reduced-ferredoxins Reduced-ferredoxins] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-253 CPD-253] ==
 
* common-name:
 
* common-name:
** a reduced ferredoxin [iron-sulfur] cluster
+
** 4,5-seco-dopa
 +
* smiles:
 +
** c(=o)c=c(cc([n+])c(=o)[o-])c=c(c([o-])=o)o
 +
* inchi-key:
 +
** fnegjfdtwwxqes-qtwonppnsa-m
 +
* molecular-weight:
 +
** 228.181
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
* [[1.18.1.2-RXN]]
 
* [[1.3.7.2-RXN]]
 
* [[1.3.7.3-RXN]]
 
* [[1.3.7.4-RXN]]
 
* [[FERREDOXIN--NITRITE-REDUCTASE-RXN]]
 
* [[GLUTAMATE-SYNTHASE-FERREDOXIN-RXN]]
 
* [[HYDROG-RXN]]
 
* [[ISPH2-RXN]]
 
* [[PYRUFLAVREDUCT-RXN]]
 
* [[R05818]]
 
* [[R05819]]
 
* [[RXN-16049]]
 
* [[RXN-16052]]
 
* [[RXN-16053]]
 
* [[RXN-16070]]
 
* [[RXN-16071]]
 
* [[RXN-16993]]
 
* [[RXN-16994]]
 
* [[RXN-1725]]
 
* [[RXN-17252]]
 
* [[RXN-1727]]
 
* [[RXN-17523]]
 
* [[RXN-17897]]
 
* [[RXN-7740]]
 
* [[RXN-7741]]
 
* [[RXN-7978]]
 
* [[RXN-7979]]
 
* [[RXN-8025]]
 
* [[RXN-8026]]
 
* [[RXN-8295]]
 
* [[RXN-8297]]
 
* [[RXN-8299]]
 
* [[RXN-8301]]
 
* [[RXN-8303]]
 
* [[RXN-8306]]
 
* [[RXN-8309]]
 
* [[RXN-8310]]
 
* [[RXN-8311]]
 
* [[RXN-8313]]
 
* [[RXN-8314]]
 
* [[RXN-8317]]
 
* [[RXN-8318]]
 
* [[RXN-8319]]
 
* [[RXN-8365]]
 
* [[RXN-8366]]
 
* [[RXN-8367]]
 
* [[RXN-8368]]
 
* [[RXN-9667]]
 
* [[RXN0-882]]
 
* [[RXN0-884]]
 
* [[RXN1F-152]]
 
* [[SULFITE-REDUCTASE-FERREDOXIN-RXN]]
 
</div>
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.18.1.2-RXN]]
+
* [[RXN-8460]]
* [[HYDROG-RXN]]
 
* [[PYRUFLAVREDUCT-RXN]]
 
* [[R05818]]
 
* [[R05819]]
 
* [[RXN-12878]]
 
* [[RXN-16993]]
 
* [[RXN-16994]]
 
* [[RXN-17897]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a reduced ferredoxin [iron-sulfur] cluster}}
+
{{#set: common-name=4,5-seco-dopa}}
 +
{{#set: inchi-key=inchikey=fnegjfdtwwxqes-qtwonppnsa-m}}
 +
{{#set: molecular-weight=228.181}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-253

  • common-name:
    • 4,5-seco-dopa
  • smiles:
    • c(=o)c=c(cc([n+])c(=o)[o-])c=c(c([o-])=o)o
  • inchi-key:
    • fnegjfdtwwxqes-qtwonppnsa-m
  • molecular-weight:
    • 228.181

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality