Difference between revisions of "SJ06016"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18761 CPD-18761] == * common-name: ** coniferyl alcohol radical * smiles: ** coc1(=cc(=ccco...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Acylcholines Acylcholines] == * common-name: ** an acylcholine == Reaction(s) known to consume...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18761 CPD-18761] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Acylcholines Acylcholines] ==
 
* common-name:
 
* common-name:
** coniferyl alcohol radical
+
** an acylcholine
* smiles:
 
** coc1(=cc(=ccco)c=cc(=o)1)
 
* inchi-key:
 
** orajwsykrgvtdp-uhfffaoysa-n
 
* molecular-weight:
 
** 179.195
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[CHOLINESTERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17351]]
 
* [[RXN-17352]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=coniferyl alcohol radical}}
+
{{#set: common-name=an acylcholine}}
{{#set: inchi-key=inchikey=orajwsykrgvtdp-uhfffaoysa-n}}
 
{{#set: molecular-weight=179.195}}
 

Revision as of 09:24, 27 August 2019

Metabolite Acylcholines

  • common-name:
    • an acylcholine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality