Difference between revisions of "SJ07337"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9867 CPD-9867] == * common-name: ** 3-(all-trans-decaprenyl)benzene-1,2-diol * smiles: ** c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DL-12-Propanediol DL-12-Propanediol] == * common-name: ** propane-1,2-diol == Reaction(s) known...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9867 CPD-9867] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DL-12-Propanediol DL-12-Propanediol] ==
 
* common-name:
 
* common-name:
** 3-(all-trans-decaprenyl)benzene-1,2-diol
+
** propane-1,2-diol
* smiles:
 
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c)c)c)c)c
 
* inchi-key:
 
** caujtfnfoamxrt-xrbhbmlssa-n
 
* molecular-weight:
 
** 791.294
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9233]]
+
* [[RXN-17622]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17617]]
 +
* [[RXN-17622]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-(all-trans-decaprenyl)benzene-1,2-diol}}
+
{{#set: common-name=propane-1,2-diol}}
{{#set: inchi-key=inchikey=caujtfnfoamxrt-xrbhbmlssa-n}}
 
{{#set: molecular-weight=791.294}}
 

Revision as of 14:20, 26 August 2019

Metabolite DL-12-Propanediol

  • common-name:
    • propane-1,2-diol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality