Difference between revisions of "SJ07762"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7409 CPD-7409] == * common-name: ** β-cryptoxanthin * smiles: ** cc(=cc=cc=c(c=cc=c(c=...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12321 CPD-12321] == * common-name: ** 15-cis-phytoene * smiles: ** cc(c)=cccc(c)=cccc(c)=cc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12321 CPD-12321] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 15-cis-phytoene |
* smiles: | * smiles: | ||
| − | ** cc | + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** yvlpjigomtxxlp-bhljudrvsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 544.946 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-11355]] |
| + | * [[RXN-12243]] | ||
| + | * [[RXN-12413]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-13323]] |
| + | * [[RXNARA-8002]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=15-cis-phytoene}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yvlpjigomtxxlp-bhljudrvsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=544.946}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-12321
- common-name:
- 15-cis-phytoene
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c
- inchi-key:
- yvlpjigomtxxlp-bhljudrvsa-n
- molecular-weight:
- 544.946
