Difference between revisions of "SJ07762"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12321 CPD-12321] == * common-name: ** 15-cis-phytoene * smiles: ** cc(c)=cccc(c)=cccc(c)=cc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-709 CPD-709] == * common-name: ** (5α)-campestan-3-one * smiles: ** cc(c)c(c)ccc(c)[c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12321 CPD-12321] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-709 CPD-709] ==
 
* common-name:
 
* common-name:
** 15-cis-phytoene
+
** (5α)-campestan-3-one
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c
+
** cc(c)c(c)ccc(c)[ch]3(cc[ch]4([ch]2(cc[ch]1(cc(=o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** yvlpjigomtxxlp-bhljudrvsa-n
+
** ddjmomhmvfxeqf-jbqstxlysa-n
 
* molecular-weight:
 
* molecular-weight:
** 544.946
+
** 400.687
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11355]]
 
* [[RXN-12243]]
 
* [[RXN-12413]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13323]]
+
* [[RXN-711]]
* [[RXNARA-8002]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=15-cis-phytoene}}
+
{{#set: common-name=(5α)-campestan-3-one}}
{{#set: inchi-key=inchikey=yvlpjigomtxxlp-bhljudrvsa-n}}
+
{{#set: inchi-key=inchikey=ddjmomhmvfxeqf-jbqstxlysa-n}}
{{#set: molecular-weight=544.946}}
+
{{#set: molecular-weight=400.687}}

Revision as of 09:23, 27 August 2019

Metabolite CPD-709

  • common-name:
    • (5α)-campestan-3-one
  • smiles:
    • cc(c)c(c)ccc(c)[ch]3(cc[ch]4([ch]2(cc[ch]1(cc(=o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • ddjmomhmvfxeqf-jbqstxlysa-n
  • molecular-weight:
    • 400.687

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality