Difference between revisions of "SJ08821"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13855 CPD-13855] == * common-name: ** n7-methylguanosine 5'-diphosphate * smiles: ** c[n+]1...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-FERULIC-ACID 5-HYDROXY-FERULIC-ACID] == * common-name: ** 5-hydroxyferulate * smiles:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-FERULIC-ACID 5-HYDROXY-FERULIC-ACID] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-hydroxyferulate |
* smiles: | * smiles: | ||
| − | ** c | + | ** coc1(c=c(c=cc([o-])=o)c=c(o)c(o)=1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** yfxwtvldsksylw-nscuhmnnsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 209.178 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-3422]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-1121]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-hydroxyferulate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yfxwtvldsksylw-nscuhmnnsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=209.178}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite 5-HYDROXY-FERULIC-ACID
- common-name:
- 5-hydroxyferulate
- smiles:
- coc1(c=c(c=cc([o-])=o)c=c(o)c(o)=1)
- inchi-key:
- yfxwtvldsksylw-nscuhmnnsa-m
- molecular-weight:
- 209.178
