Difference between revisions of "SJ09623"

Revision as of 09:25, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8079 CPD-8079] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-uridine65 tRNA-uridine65] ==
 * common-name:
-** 1-18:1-2-16:3-monogalactosyldiacylglycerol
+** a uridine65 in trna
-* smiles:
-** ccccccccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=ccc=ccc)=o)=o
-* inchi-key:
-** uledcqdcqahgfd-lukloydesa-n
-* molecular-weight:
-** 751.052
 == Reaction(s) known to consume the compound ==
+* [[RXN-11840]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-8303]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=1-18:1-2-16:3-monogalactosyldiacylglycerol}}
+{{#set: common-name=a uridine65 in trna}}
-{{#set: inchi-key=inchikey=uledcqdcqahgfd-lukloydesa-n}}
-{{#set: molecular-weight=751.052}}