Difference between revisions of "SJ11752"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYDROXY-METHYL-BUTENYL-DIP HYDROXY-METHYL-BUTENYL-DIP] == * common-name: ** (e)-4-hydroxy-3-met...")
(Created page with "Category:gene == Gene SJ11752 == * transcription-direction: ** negative * right-end-position: ** 232994 * left-end-position: ** 209060 * centisome-position: ** 56.937893...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYDROXY-METHYL-BUTENYL-DIP HYDROXY-METHYL-BUTENYL-DIP] ==
+
== Gene SJ11752 ==
−
* common-name:
+
* transcription-direction:
−
** (e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate
+
** negative
−
* smiles:
+
* right-end-position:
−
** cc(co)=ccop(op([o-])(=o)[o-])(=o)[o-]
+
** 232994
−
* inchi-key:
+
* left-end-position:
−
** mdsizrkjvdmqoq-gorduthdsa-k
+
** 209060
−
* molecular-weight:
+
* centisome-position:
−
** 259.069
+
** 56.937893   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[HDS]]
+
* [[S.japonica_carotenoid_curated]]
−
* [[IDS1]]
+
== Reaction(s) associated ==
−
* [[IDS2]]
+
* [[GSADENYLATION-RXN]]
−
* [[ISPH2-RXN]]
+
** Category: [[orthology]]
−
* [[RXN0-884]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
−
== Reaction(s) known to produce the compound ==
+
* [[NITRATREDUCT-RXN]]
−
* [[HDS]]
+
** Category: [[annotation]]
−
* [[RXN-15878]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[RXN0-882]]
+
* [[RXN-8344]]
−
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
−
{{#set: common-name=(e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: inchi-key=inchikey=mdsizrkjvdmqoq-gorduthdsa-k}}
+
** Category: [[orthology]]
−
{{#set: molecular-weight=259.069}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
* [[RXN-8348]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY-6823]]
 +
** '''7''' reactions found over '''6''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=232994}}
 +
{{#set: left-end-position=209060}}
 +
{{#set: centisome-position=56.937893    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=4}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:03, 18 March 2021

Gene SJ11752

  • transcription-direction:
    • negative
  • right-end-position:
    • 232994
  • left-end-position:
    • 209060
  • centisome-position:
    • 56.937893

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-6823
    • 7 reactions found over 6 reactions in the full pathway




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ11752&oldid=133047"